CAS 120165-53-9

1-Amino-4-methoxy-2,3,5-trimethylbenzene

Description:

1-Amino-4-methoxy-2,3,5-trimethylbenzene, also known by its CAS number 120165-53-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a methoxy group, and multiple methyl groups. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The methoxy group contributes to its electron-donating characteristics, influencing its reactivity and stability. The presence of multiple methyl groups enhances its hydrophobicity and may affect its boiling and melting points. In terms of applications, compounds of this nature can be utilized in the synthesis of dyes, pharmaceuticals, and agrochemicals, owing to their functional groups that can participate in various chemical reactions. Safety considerations are important, as aromatic amines can pose health risks, necessitating proper handling and disposal protocols. Overall, 1-amino-4-methoxy-2,3,5-trimethylbenzene is a versatile compound with significant implications in organic chemistry and industrial applications.

Formula: C₁₀H₁₅NO

InChI: InChI=1S/C10H15NO/c1-6-5-9(11)7(2)8(3)10(6)12-4/h5H,11H2,1-4H3

InChI key: InChIKey=GQHIURVYQWJLSL-UHFFFAOYSA-N

SMILES: O(C)C1=C(C)C(C)=C(N)C=C1C

Synonyms:

• Benzenamine, 4-methoxy-2,3,5-trimethyl-
• 1-Amino-4-methoxy-2,3,5-trimethylbenzene
• 4-Methoxy-2,3,5-trimethylbenzenamine