CymitQuimica logo

CAS 1201657-10-4

:

5-Ethynyl-1,2-dimethyl-1H-imidazole

Description:
5-Ethynyl-1,2-dimethyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered aromatic structure containing two nitrogen atoms. This compound features an ethynyl group (-C≡CH) at the 5-position and two methyl groups at the 1 and 2 positions of the imidazole ring. The presence of the ethynyl group introduces a degree of reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The imidazole moiety is known for its biological significance, often found in various natural products and pharmaceuticals. The compound's properties, such as solubility and stability, can be influenced by the substituents on the imidazole ring. Additionally, its unique structure may exhibit interesting electronic properties, making it a candidate for studies in materials science and drug development. Overall, 5-Ethynyl-1,2-dimethyl-1H-imidazole represents a versatile scaffold in chemical research.
Formula:C7H8N2
InChI:InChI=1S/C7H8N2/c1-4-7-5-8-6(2)9(7)3/h1,5H,2-3H3
InChI key:InChIKey=FLBRASZYLXQMBC-UHFFFAOYSA-N
SMILES:C(#C)C=1N(C)C(C)=NC1
Synonyms:
  • 1H-Imidazole, 5-ethynyl-1,2-dimethyl-
  • 5-Ethynyl-1,2-dimethyl-1H-imidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.