CAS 1201657-30-8
:4-Chloro-5-(1-methylethyl)-2-pyrimidinamine
Description:
4-Chloro-5-(1-methylethyl)-2-pyrimidinamine, with the CAS number 1201657-30-8, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a chloro group at the 4-position and an isopropyl group at the 5-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the pyrimidine structure can influence biological activity and pharmacokinetics. The compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is studied. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C7H10ClN3
InChI:InChI=1S/C7H10ClN3/c1-4(2)5-3-10-7(9)11-6(5)8/h3-4H,1-2H3,(H2,9,10,11)
InChI key:InChIKey=FUSBTPXAPLWXHI-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C(Cl)=NC(N)=NC1
Synonyms:- 2-Pyrimidinamine, 4-chloro-5-(1-methylethyl)-
- 4-Chloro-5-(1-methylethyl)-2-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
