
CAS 1201657-90-0
:4-(4-Bromo-1H-pyrazol-1-yl)-1-(1-methylethyl)piperidine
Description:
4-(4-Bromo-1H-pyrazol-1-yl)-1-(1-methylethyl)piperidine is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyrazole moiety. The presence of a bromine atom at the para position of the pyrazole ring contributes to its reactivity and potential biological activity. The isopropyl group attached to the piperidine nitrogen enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals, where it may serve as a lead compound for further modifications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the bromine atom and the piperidine ring, which are critical factors in determining its behavior in chemical reactions and biological systems. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.
Formula:C11H18BrN3
InChI:InChI=1S/C11H18BrN3/c1-9(2)14-5-3-11(4-6-14)15-8-10(12)7-13-15/h7-9,11H,3-6H2,1-2H3
InChI key:InChIKey=DTYIRSUMIHQFNX-UHFFFAOYSA-N
SMILES:BrC1=CN(C2CCN(C(C)C)CC2)N=C1
Synonyms:- Piperidine, 4-(4-bromo-1H-pyrazol-1-yl)-1-(1-methylethyl)-
- 4-(4-Bromo-1H-pyrazol-1-yl)-1-(1-methylethyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.