CAS 120166-70-3

1,4-Bis[3-(4-chlorophenyl)propyl]piperazine

Description:

1,4-Bis[3-(4-chlorophenyl)propyl]piperazine, identified by its CAS number 120166-70-3, is a chemical compound characterized by its piperazine core structure, which is substituted at the 1 and 4 positions with 3-(4-chlorophenyl)propyl groups. This compound typically exhibits properties associated with piperazine derivatives, such as potential psychoactive effects and interactions with various neurotransmitter systems. It is often studied for its pharmacological activities, particularly in the context of central nervous system effects. The presence of the 4-chlorophenyl groups may enhance lipophilicity, influencing its bioavailability and receptor binding affinity. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological disorders. However, detailed studies on its specific biological activities, toxicity, and environmental impact are essential for a comprehensive understanding of its characteristics and potential uses. As with many chemical substances, proper handling and safety measures are crucial due to potential health risks associated with exposure.

Formula: C₂₂H₂₈Cl₂N₂

InChI: InChI=1S/C22H28Cl2N2/c23-21-9-5-19(6-10-21)3-1-13-25-15-17-26(18-16-25)14-2-4-20-7-11-22(24)12-8-20/h5-12H,1-4,13-18H2

InChI key: InChIKey=UKUYCOVERBAHBL-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)N2CCN(CCCC3=CC=C(Cl)C=C3)CC2

Synonyms:

• 1,4-Bis[3-(4-chlorophenyl)propyl]piperazine
• Piperazine, 1,4-bis[3-(4-chlorophenyl)propyl]-

Piperazine, 1,4-bis[3-(4-chlorophenyl)propyl]-

CAS: 120166-70-3

Formula: C₂₂H₂₈Cl₂N₂

Molecular weight: 391.3771

Ref: IN-DA000QGE