CymitQuimica logo

CAS 1201784-86-2

:

7-(1,1-Dimethylethyl) 3-methyl 5,8-dihydro-1,7-naphthyridine-3,7(6H)-dicarboxylate

Description:
7-(1,1-Dimethylethyl) 3-methyl 5,8-dihydro-1,7-naphthyridine-3,7(6H)-dicarboxylate, with the CAS number 1201784-86-2, is a chemical compound characterized by its complex structure, which includes a naphthyridine core. This compound features two carboxylate functional groups, contributing to its potential acidity and reactivity. The presence of a tert-butyl group (1,1-dimethylethyl) and a methyl group enhances its hydrophobic characteristics, which may influence its solubility in organic solvents. The dihydro form indicates that it has saturated bonds in certain positions, which can affect its stability and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and may vary based on purity and environmental conditions. Overall, this compound represents a unique structure with potential applications in various fields of chemistry and biology.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c1-15(2,3)21-14(19)17-6-5-10-7-11(13(18)20-4)8-16-12(10)9-17/h7-8H,5-6,9H2,1-4H3
InChI key:InChIKey=RGFVBWWCPBXDSB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C2C(CN(C(OC(C)(C)C)=O)CC2)=NC1
Synonyms:
  • 1,7-Naphthyridine-3,7(6H)-dicarboxylic acid, 5,8-dihydro-, 7-(1,1-dimethylethyl) 3-methyl ester
  • 7-(1,1-Dimethylethyl) 3-methyl 5,8-dihydro-1,7-naphthyridine-3,7(6H)-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.