CymitQuimica logo

CAS 1201784-91-9

:

1-(4-Fluorophenyl)-2-phenyl-3-pyrrolidinecarboxylic acid

Description:
1-(4-Fluorophenyl)-2-phenyl-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and multiple aromatic groups. The presence of a fluorine atom on the phenyl ring contributes to its unique electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound is typically classified as an amino acid derivative due to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit significant biological activity. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the presence of multiple aromatic systems may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, 1-(4-Fluorophenyl)-2-phenyl-3-pyrrolidinecarboxylic acid represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C17H16FNO2
InChI:InChI=1S/C17H16FNO2/c18-13-6-8-14(9-7-13)19-11-10-15(17(20)21)16(19)12-4-2-1-3-5-12/h1-9,15-16H,10-11H2,(H,20,21)
InChI key:InChIKey=BFGHJMRRQMLSCM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(N(CC1)C2=CC=C(F)C=C2)C3=CC=CC=C3
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-(4-fluorophenyl)-2-phenyl-
  • 1-(4-Fluorophenyl)-2-phenyl-3-pyrrolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.