CAS 1201785-02-5

4-Thiazolemethanamine, 2-bromo-, hydrobromide (1:1)

Description:

4-Thiazolemethanamine, 2-bromo-, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring structure, which contributes to its unique reactivity and properties. The presence of a bromine atom at the 2-position of the thiazole enhances its electrophilic character, making it suitable for various chemical reactions, including nucleophilic substitutions. As a hydrobromide salt, it is typically encountered in a solid form, exhibiting good solubility in polar solvents such as water and alcohols. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the development of antimicrobial or anticancer agents. Its molecular structure suggests that it may participate in diverse chemical transformations, making it a valuable intermediate in organic synthesis. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings. Overall, 4-Thiazolemethanamine, 2-bromo-, hydrobromide (1:1) represents a versatile building block in synthetic chemistry.

Formula: C₄H₅BrN₂S·BrH

InChI: InChI=1S/C4H5BrN2S.BrH/c5-4-7-3(1-6)2-8-4;/h2H,1,6H2;1H

InChI key: InChIKey=IELZAMRHZFSLGR-UHFFFAOYSA-N

SMILES: C(N)C=1N=C(Br)SC1.Br

Synonyms:

• 4-Thiazolemethanamine, 2-bromo-, hydrobromide (1:1)