CymitQuimica logo

CAS 1201788-49-9

:

B-(5-Butyl-2-pyridinyl)boronic acid

Description:
B-(5-Butyl-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring with a butyl substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine moiety can enhance its solubility in organic solvents and may influence its reactivity and interaction with biological targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The butyl group contributes to the hydrophobic character of the molecule, potentially affecting its biological activity and interaction with other molecules. Overall, B-(5-Butyl-2-pyridinyl)boronic acid is a versatile compound with significant implications in synthetic chemistry and drug development.
Formula:C9H14BNO2
InChI:InChI=1S/C9H14BNO2/c1-2-3-4-8-5-6-9(10(12)13)11-7-8/h5-7,12-13H,2-4H2,1H3
InChI key:InChIKey=UYJOIDIQDIDRHV-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(CCCC)C=N1
Synonyms:
  • Boronic acid, B-(5-butyl-2-pyridinyl)-
  • B-(5-Butyl-2-pyridinyl)boronic acid
  • (5-Butylpyridin-2-yl)boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.