CAS 1201803-09-9

5-Fluoro-3-pyridinecarboximidamide

Description:

5-Fluoro-3-pyridinecarboximidamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position of the pyridine ring contributes to its unique reactivity and potential biological activity. The carboximidamide functional group indicates that the compound contains both an amine and an imine, which can influence its interactions in biological systems. This compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a candidate for further research in drug design. Additionally, the compound's specific interactions with biological targets can be explored through various assays, contributing to its potential utility in therapeutic applications. Overall, 5-Fluoro-3-pyridinecarboximidamide represents a class of compounds that may have significant implications in chemical and pharmaceutical research.

Formula: C₆H₆FN₃

InChI: InChI=1S/C6H6FN3/c7-5-1-4(6(8)9)2-10-3-5/h1-3H,(H3,8,9)

InChI key: InChIKey=BTLMVSXTXYJTNE-UHFFFAOYSA-N

SMILES: C(=N)(N)C=1C=C(F)C=NC1

Synonyms:

• 3-Pyridinecarboximidamide, 5-fluoro-
• 5-Fluoro-3-pyridinecarboximidamide