CAS 120181-07-9: 1-[(O-β-D-Glucopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthracenedione
Description:The chemical substance known as 1-[(O-β-D-Glucopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthracenedione, with the CAS number 120181-07-9, is a complex glycosylated anthraquinone derivative. This compound features a core anthraquinone structure, which is characterized by its three fused aromatic rings and is known for its vibrant color and potential biological activity. The presence of multiple β-D-glucopyranosyl units indicates that it is a glycoside, suggesting that it may exhibit enhanced solubility in water and potential interactions with biological systems. The hydroxyl and methyl groups contribute to its reactivity and may influence its pharmacological properties. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in areas like cancer treatment or as antimicrobial agents, due to their ability to intercalate with DNA or disrupt cellular processes. Overall, this substance represents a fascinating intersection of carbohydrate chemistry and organic compounds with potential therapeutic significance.
Formula:C33H40O19
InChI:InChI=1S/C33H40O19/c1-10-5-12-19(24(41)18-11(20(12)37)3-2-4-13(18)36)14(6-10)48-32-27(44)26(43)22(39)17(51-32)9-47-31-29(46)30(23(40)16(8-35)49-31)52-33-28(45)25(42)21(38)15(7-34)50-33/h2-6,15-17,21-23,25-36,38-40,42-46H,7-9H2,1H3/t15-,16-,17-,21-,22-,23-,25+,26+,27-,28-,29-,30+,31-,32-,33+/m1/s1
InChI key:InChIKey=SOWISUOFXLRAML-VULFOYAMSA-N
SMILES:O=C1C=2C=CC=C(O)C2C(=O)C3=C(OC4OC(COC5OC(CO)C(O)C(OC6OC(CO)C(O)C(O)C6O)C5O)C(O)C(O)C4O)C=C(C=C13)C
- Synonyms:
- Chrysophanol 1-O-β-D-Glucopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-O-β-D-glucopyranoside
- 9,10-Anthracenedione, 1-[(O-β-D-glucopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-
- 1-[(β-D-Glucopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-O-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthraquinone
- 1-[(O-β-D-Glucopyranosyl-(1→3)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthracenedione

Ref: 7W-GY0557
Undefined size | To inquire |

Chrysophanol triglucoside
Ref: TM-T38587
1mg | 231.00 € |

Ref: BP-BP4458
5mg | 365.00 € |

Chrysophanol triglucoside
Ref: 3D-VEA18107
25mg | 1,197.00 € | ||
50mg | 1,664.00 € |