
CAS 1201845-13-7
:2-Chloro-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinamine
Description:
2-Chloro-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a dimethylamino group, as well as a boron-containing moiety. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. The dimethylamino group contributes to the compound's basicity and can influence its solubility in various solvents. The tetramethyl-1,3,2-dioxaborolane unit is notable for its role in organoboron chemistry, often utilized in cross-coupling reactions and as a reagent in organic synthesis. This compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. Safety and handling considerations should be taken into account due to the presence of chlorine and potential reactivity associated with the boron moiety.
Formula:C13H20BClN2O2
InChI:InChI=1S/C13H20BClN2O2/c1-12(2)13(3,4)19-14(18-12)9-7-10(17(5)6)11(15)16-8-9/h7-8H,1-6H3
InChI key:InChIKey=KUECXKAKVLAAAA-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(N(C)C)C(Cl)=NC2
Synonyms:- 2-Chloro-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinamine
- 2-Chloro-N,N-dimethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine
- 3-Pyridinamine, 2-chloro-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chloro-n,n-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine
CAS:Formula:C13H20BClN2O2Molecular weight:282.5741
