CAS 1201924-32-4

6-Chloro-3-methyl-2-pyridinecarboxylic acid

Description:

6-Chloro-3-methyl-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group and at the 6-position with a chlorine atom. The presence of the methyl group at the 3-position contributes to its overall molecular structure and influences its chemical reactivity. This compound typically exhibits properties associated with carboxylic acids, such as acidity and the ability to form salts and esters. The chlorine substituent can affect the compound's polarity, solubility, and reactivity, making it useful in various chemical syntheses and applications. Additionally, the presence of the pyridine ring suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Overall, 6-Chloro-3-methyl-2-pyridinecarboxylic acid is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₇H₆ClNO₂

InChI: InChI=1S/C7H6ClNO2/c1-4-2-3-5(8)9-6(4)7(10)11/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=ODSPBBWQVLWOPG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C)C=CC(Cl)=N1

Synonyms:

• 6-Chloro-3-methyl-2-pyridinecarboxylic acid
• 6-Chloro-3-methylpicolinic acid
• 6-Chloro-3-methylpyridine-2-carboxylic acid
• 2-Pyridinecarboxylic acid, 6-chloro-3-methyl-

6-Chloro-3-methylpicolinic acid

CAS: 1201924-32-4

Formula: C₇H₆ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.5810

Ref: IN-DA000QJO

6-Chloro-3-methylpicolinic acid

CAS: 1201924-32-4

6-Chloro-3-methylpicolinic acid

Purity: 98%

Molecular weight: 171.58g/mol

Ref: 54-OR926007

6-Chloro-3-methylpicolinic acid

CAS: 1201924-32-4

Formula: C₇H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F230870