CAS 1201935-91-2

2-Amino-N,6-dimethoxybenzamide

Description:

2-Amino-N,6-dimethoxybenzamide is an organic compound characterized by its amine and amide functional groups, which contribute to its reactivity and potential biological activity. The presence of two methoxy groups at the 6-position of the benzene ring enhances its solubility in organic solvents and may influence its interaction with biological targets. This compound typically appears as a solid at room temperature and is likely to be stable under standard conditions, although it may be sensitive to moisture or extreme pH levels. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The amino group can participate in hydrogen bonding, which may enhance its binding affinity to biological macromolecules. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the presence of substituents and the overall molecular configuration. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1S/C9H12N2O3/c1-13-7-5-3-4-6(10)8(7)9(12)11-14-2/h3-5H,10H2,1-2H3,(H,11,12)

InChI key: InChIKey=DMBVFWUZQWADNT-UHFFFAOYSA-N

SMILES: C(NOC)(=O)C1=C(OC)C=CC=C1N

Synonyms:

• Benzamide, 2-amino-N,6-dimethoxy-
• 2-Amino-N,6-dimethoxybenzamide