CAS 1202-34-2
:2,2′-Dipyridylamine
Description:
2,2′-Dipyridylamine, with the CAS number 1202-34-2, is an organic compound characterized by its structure, which consists of two pyridine rings connected by an amine group. This compound is typically a solid at room temperature and is known for its ability to form chelates with metal ions, making it useful in coordination chemistry. It exhibits moderate solubility in polar organic solvents, while being less soluble in non-polar solvents. The presence of nitrogen atoms in the pyridine rings contributes to its basicity and potential for hydrogen bonding. 2,2′-Dipyridylamine is often employed in analytical chemistry as a reagent for the detection of various metal ions, particularly in the context of environmental and biological studies. Additionally, it has applications in the synthesis of other chemical compounds and in the development of sensors. Its stability and reactivity can vary depending on the conditions, such as pH and the presence of other ligands or metal ions.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h1-8H,(H,11,12,13)
InChI key:InChIKey=HMMPCBAWTWYFLR-UHFFFAOYSA-N
SMILES:N(C1=CC=CC=N1)C2=CC=CC=N2
Synonyms:- 2,2′-Dipyridylamine
- N-2-Pyridinyl-2-pyridinamine
- 2-Pyridinamine, N-2-pyridinyl-
- Di-2-pyridylamine
- Pyridine, 2,2′-iminodi-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
2,2'-Dipyridylamine
CAS:Formula:C10H9N3Purity:>99.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:171.20Chlorpheniramine Related Compound B (di(pyridin-2-yl)amine)
CAS:Compounds containing an unfused pyridine ring in the structure, nesoiFormula:C10H9N3Color and Shape:PowderMolecular weight:171.079652-Pyridinamine, N-2-pyridinyl-
CAS:Formula:C10H9N3Purity:98%Color and Shape:SolidMolecular weight:171.1986Chlorphenamine EP Impurity B (Chlorpheniramine USP Related Compound B)
CAS:Formula:C10H9N3Color and Shape:White To Off-White SolidMolecular weight:171.202,2'-Dipyridylamine
CAS:2,2'-DipyridylamineFormula:C10H9N3Purity:98%Color and Shape: white to yellow solidMolecular weight:171.20g/molN-(Pyridin-2-yl)pyridin-2-amine (2,2'-Dipyridylamine)
CAS:Controlled ProductFormula:C10H9N3Color and Shape:NeatMolecular weight:171.20Di(pyridin-2-yl)amine
CAS:Di(pyridin-2-yl)amine is a pyridine derivative widely used in biochemical experiments and drug synthesis research.Formula:C10H9N3Purity:99.83%Color and Shape:SolidMolecular weight:171.22,2'-Dipyridylamine
CAS:Controlled Product<p>Impurity Chlorpheniramine EP Impurity B<br>Applications A metal-complexing agent; an effective iron chelating agent to help protect against UVB radiation. An impurity of Chlorpheniramine Maleate (C424300).<br>References Bissett, D. et al.: Photochem. Photobiol., 54, 215 (1991); Patel, M.H. et al.: J. Enzyme Inhib. Med. Chem., 26, 188 (2011);<br></p>Formula:C10H9N3Color and Shape:BeigeMolecular weight:171.202,2'-Dipyridylamine
CAS:<p>2,2'-Dipyridylamine is a compound that belongs to the group of low-energy compounds. It has been shown to have antimicrobial activity against bacteria and fungi and has been demonstrated to be effective in treating cancer cells. 2,2'-Dipyridylamine is a molecule with two nitrogen atoms, which are bound by hydrogen bonds. This compound also contains methoxy groups that are coordinated by the nitrogen atoms. The structural analysis shows that there are three open coordination sites for metal ions that can bind with the nitrogen atoms. The x-ray diffraction data show that 2,2'-dipyridylamine crystallizes in a monoclinic system with an orthorhombic unit cell.</p>Formula:C10H9N3Purity:Min. 95%Molecular weight:171.2 g/mol











