CAS 1202-60-4

(2Z)-3-(4-chlorophenyl)-2-methylprop-2-enoic acid

Description:

(2Z)-3-(4-chlorophenyl)-2-methylprop-2-enoic acid, also known as 4-chlorophenyl methacrylate, is an organic compound characterized by its unsaturated carboxylic acid structure. It features a double bond between the second and third carbon atoms, contributing to its reactivity. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its biological activity. This compound typically appears as a colorless to pale yellow liquid and has a distinct aromatic odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic characteristics. The compound is often utilized in polymer chemistry, particularly in the synthesis of various copolymers and as a monomer in the production of plastics and resins. Its reactivity allows for participation in various chemical reactions, including polymerization and esterification. Safety precautions should be taken when handling this substance, as it may pose health risks upon exposure.

Formula: C₁₀H₉ClO₂

InChI: InChI=1/C10H9ClO2/c1-7(10(12)13)6-8-2-4-9(11)5-3-8/h2-6H,1H3,(H,12,13)/b7-6-

SMILES: C/C(=C/c1ccc(cc1)Cl)/C(=O)O

3-(4-Chlorophenyl)-2-methylacrylic acid

CAS: 1202-60-4

3-(4-Chlorophenyl)-2-methylacrylic acid

Purity: 95%

Molecular weight: 196.63g/mol

Ref: 54-OR1064488