CAS 120200-05-7

6,6,6-Trifluoro-L-norleucine

Description:

6,6,6-Trifluoro-L-norleucine is a synthetic amino acid derivative characterized by the presence of three fluorine atoms attached to the carbon backbone of the norleucine structure. This modification significantly alters its physicochemical properties, including increased hydrophobicity and potential bioactivity. The trifluoromethyl group can influence the molecule's interactions with biological systems, potentially enhancing its stability and altering its conformational dynamics. As a non-canonical amino acid, it may be utilized in peptide synthesis and drug design, particularly in the development of therapeutics that require specific binding properties or enhanced metabolic stability. The presence of fluorine atoms can also affect the compound's solubility and reactivity, making it a valuable tool in medicinal chemistry. Additionally, 6,6,6-Trifluoro-L-norleucine may exhibit unique properties in terms of its interaction with enzymes and receptors, which can be explored in various biochemical applications. However, detailed studies on its biological effects and safety profile are essential for understanding its full potential in research and therapeutic contexts.

Formula: C₆H₁₀F₃NO₂

InChI: InChI=1S/C6H10F3NO2/c7-6(8,9)3-1-2-4(10)5(11)12/h4H,1-3,10H2,(H,11,12)/t4-/m0/s1

InChI key: InChIKey=RUEWGWBXZIDRJY-BYPYZUCNSA-N

SMILES: C(C[C@@H](C(O)=O)N)CC(F)(F)F

Synonyms:

• 6,6,6-Trifluoro-L-norleucine
• L-Norleucine, 6,6,6-trifluoro-
• (2S)-2-Amino-6,6,6-trifluorohexanoic acid
• (L)-2-Amino-6,6,6-trifluorohexanoic acid