CymitQuimica logo

CAS 120200-07-9

:

(2R)-2-Amino-4,4,4-trifluorobutanoic acid

Description:
(2R)-2-Amino-4,4,4-trifluorobutanoic acid, with the CAS number 120200-07-9, is an amino acid derivative characterized by the presence of a trifluoromethyl group at the 4-position of the butanoic acid chain. This compound features a chiral center at the second carbon, contributing to its stereochemistry as the (2R) isomer. The trifluoromethyl group imparts unique electronic and steric properties, making it of interest in various chemical and pharmaceutical applications. The presence of the amino group (-NH2) allows it to participate in typical amino acid reactions, such as peptide bond formation. Additionally, the carboxylic acid group (-COOH) contributes to its acidic properties. This compound may exhibit interesting biological activities due to its structural features, and its fluorinated nature can enhance lipophilicity and metabolic stability. Overall, (2R)-2-Amino-4,4,4-trifluorobutanoic acid is a valuable compound in medicinal chemistry and materials science, with potential applications in drug design and synthesis.
Formula:C4H6F3NO2
InChI:InChI=1S/C4H6F3NO2/c5-4(6,7)1-2(8)3(9)10/h2H,1,8H2,(H,9,10)/t2-/m1/s1
InChI key:InChIKey=AQPCXCOPDSEKQT-UWTATZPHSA-N
SMILES:[C@@H](CC(F)(F)F)(C(O)=O)N
Synonyms:
  • (2R)-2-Amino-4,4,4-trifluorobutanoic acid
  • (D)-2-Amino-4,4,4-trifluorobutanoic acid
  • (2r)-2-Amino-4,4,4-trifluorobutanoic acid
  • Butanoic acid, 2-amino-4,4,4-trifluoro-, (2R)-
  • Butanoic acid, 2-amino-4,4,4-trifluoro-, (R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.