
CAS 1202006-86-7
:6-Fluoro-1-methoxy-5,7-dimethylisoquinoline
Description:
6-Fluoro-1-methoxy-5,7-dimethylisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic aromatic system. The presence of a fluorine atom at the 6-position and a methoxy group at the 1-position contributes to its unique reactivity and potential biological activity. The two methyl groups at the 5 and 7 positions enhance its lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its CAS number, 1202006-86-7, allows for easy identification in chemical databases. As with many isoquinoline derivatives, it may possess various biological activities, including antimicrobial or anticancer properties, although specific studies would be necessary to elucidate its full potential. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.
Formula:C12H12FNO
InChI:InChI=1S/C12H12FNO/c1-7-6-10-9(8(2)11(7)13)4-5-14-12(10)15-3/h4-6H,1-3H3
InChI key:InChIKey=QNYYYNPONZIYLV-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(C)=C(F)C(C)=C2)C=CN1
Synonyms:- 6-Fluoro-1-methoxy-5,7-dimethylisoquinoline
- Isoquinoline, 6-fluoro-1-methoxy-5,7-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.