
CAS 120202-68-8
:Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, (1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1)
Description:
Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, (1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1), with CAS number 120202-68-8, is a complex organic compound characterized by its unique bicyclic structure and the presence of multiple functional groups. This substance features a thieno-pyridine core, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of a methyl ester group suggests it may exhibit esterification properties, while the methanesulfonate moiety can enhance solubility and stability in various solvents. The compound's stereochemistry, indicated by the (αS) and (1R,4S) descriptors, suggests specific spatial arrangements that may influence its interaction with biological targets. Additionally, the presence of a chlorophenyl group may impart unique electronic properties, potentially affecting its reactivity and pharmacological profile. Overall, this compound's intricate structure and functional diversity make it a subject of interest in chemical research, particularly in the development of pharmaceuticals.
Formula:C16H16ClNO2S·C10H16O4S
InChI:InChI=1S/C16H16ClNO2S.C10H16O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h2-5,7,9,15H,6,8,10H2,1H3;7H,3-6H2,1-2H3,(H,12,13,14)/t15-;7-,10-/m00/s1
InChI key:InChIKey=XEENARPWPCQXST-LGPMUQLOSA-N
SMILES:[C@H](C(OC)=O)(N1CC2=C(CC1)SC=C2)C3=C(Cl)C=CC=C3.C(S(=O)(=O)O)[C@]12[C@@](C)(C)[C@](CC1=O)(CC2)[H]
Synonyms:- Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (S)-, (1R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate
- Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, (1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate
- Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1R,4S)-, compd. with methyl (αS)-α-(2-chlorophenyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-acetate (1:1)
- Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, (1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1)
- Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1R)-, compd. with (S)-methyl α-(2-chlorophenyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-acetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
