CAS 120209-12-3
:ethyl 2-(hydroxyimino)-2-piperidinoacetate
Description:
Ethyl 2-(hydroxyimino)-2-piperidinoacetate, identified by its CAS number 120209-12-3, is a chemical compound characterized by its unique functional groups and structural features. It contains an ethyl ester moiety, a hydroxyimino group, and a piperidine ring, which contribute to its potential biological activity. The presence of the hydroxyimino group suggests that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. The piperidine ring adds to the compound's basicity and may influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the ethyl ester component can affect its solubility and permeability, which are critical factors in pharmacokinetics. Overall, this compound's structural characteristics suggest potential applications in drug development, particularly in the synthesis of compounds with therapeutic properties. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C9H16N2O3
InChI:InChI=1/C9H16N2O3/c1-2-14-9(12)8(10-13)11-6-4-3-5-7-11/h13H,2-7H2,1H3/b10-8+
Synonyms:- ethyl (2E)-2-hydroxyimino-2-(1-piperidyl)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Z)-Ethyl 2-(hydroxyimino)-2-(piperidin-1-yl)acetate
CAS:Formula:C9H16N2O3Color and Shape:SolidMolecular weight:200.2349
