CAS 1202174-18-2

(1S)-3,3-Difluorocyclohexanamine

Description:

(1S)-3,3-Difluorocyclohexanamine is a chiral amine characterized by the presence of a cyclohexane ring with two fluorine atoms attached to the same carbon atom, specifically at the 3-position, and an amino group at the 1-position. This compound exhibits a unique stereochemistry due to its chiral center, which can influence its reactivity and interactions in biological systems. The difluorination introduces significant electronegativity, potentially affecting the compound's polarity and solubility in various solvents. As an amine, it can participate in hydrogen bonding, which may enhance its solubility in polar solvents. The presence of fluorine atoms can also impart unique properties, such as increased lipophilicity and altered metabolic stability. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₆H₁₁F₂N

InChI: InChI=1S/C6H11F2N/c7-6(8)3-1-2-5(9)4-6/h5H,1-4,9H2/t5-/m0/s1

InChI key: InChIKey=VAQNIUDWPOLHBT-YFKPBYRVSA-N

SMILES: FC1(F)C[C@@H](N)CCC1

Synonyms:

• (1S)-3,3-Difluorocyclohexan-1-amine
• Cyclohexanamine, 3,3-difluoro-, (1S)-
• (1S)-3,3-Difluorocyclohexanamine