
CAS 1202179-31-4
:2-(2-Chlorophenyl)-2,7-diazaspiro[4.4]nonane
Description:
2-(2-Chlorophenyl)-2,7-diazaspiro[4.4]nonane is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms incorporated into the ring system. The presence of the 2-chlorophenyl group contributes to its aromatic character and may influence its reactivity and interaction with biological targets. This compound is of interest in medicinal chemistry and pharmacology due to its potential biological activities, which may include effects on neurotransmitter systems or other cellular pathways. The diazaspiro structure can impart specific conformational properties, potentially affecting its binding affinity and selectivity for various receptors or enzymes. Additionally, the chlorine substituent may enhance lipophilicity, impacting the compound's solubility and permeability. As with many nitrogen-containing heterocycles, the compound may exhibit diverse chemical reactivity, making it a candidate for further synthetic modifications or applications in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C13H17ClN2
InChI:InChI=1S/C13H17ClN2/c14-11-3-1-2-4-12(11)16-8-6-13(10-16)5-7-15-9-13/h1-4,15H,5-10H2
InChI key:InChIKey=XFGGWQFGZJYQBL-UHFFFAOYSA-N
SMILES:ClC1=C(N2CC3(CC2)CCNC3)C=CC=C1
Synonyms:- 2,7-Diazaspiro[4.4]nonane, 2-(2-chlorophenyl)-
- 2-(2-Chlorophenyl)-2,7-diazaspiro[4.4]nonane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.