CAS 120218-45-3: 1-Phenylcyclobutylamine hydrochloride
Description:1-Phenylcyclobutylamine hydrochloride is a chemical compound characterized by its unique structure, which includes a cyclobutane ring fused with a phenyl group and an amine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the amine group suggests potential basicity, allowing it to form salts, such as the hydrochloride form, which enhances its stability and solubility. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. As with many amines, it may exhibit properties such as hydrogen bonding, influencing its reactivity and interaction with biological systems. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Always refer to material safety data sheets (MSDS) and relevant literature for detailed information on handling and potential applications.
Formula:C10H14ClN
InChI:InChI=1/C10H13N.ClH/c11-10(7-4-8-10)9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8,11H2;1H
- Synonyms:
- 1-Phenylcyclobutanamine
- Cyclobutanamine, 1-Phenyl-
- 1-Phenylcyclobutanamine Hydrochloride (1:1)
- 1-Phenylcyclobutanamine HCl
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-Phenylcyclobutanamine hydrochloride REF: IN-DA003EMCCAS: 120218-45-3 | 95% | 59.00 €~660.00 € | Mon 14 Apr 25 |
 | 1-Phenylcyclobutanamine hydrochloride REF: 54-OR73895CAS: 120218-45-3 | 0.95 | 129.00 €~1,383.00 € | Tue 15 Apr 25 |
 | 1-PHENYLCYCLOBUTYLAMINE HCL REF: 10-F305002CAS: 120218-45-3 | 95.0% | 29.00 €~685.00 € | Thu 17 Apr 25 |
 | 1-Phenylcyclobutanamine HCl REF: 3D-FP140863CAS: 120218-45-3 | Min. 95% | - - - | Discontinued product |
1-Phenylcyclobutanamine hydrochloride
Ref: IN-DA003EMC
| 1g | 195.00 € | ||
| 100mg | 59.00 € | ||
| 250mg | 85.00 € |
Ref: 54-OR73895
| 1g | 396.00 € | ||
| 5g | 1,383.00 € | ||
| 250mg | 129.00 € |
1-PHENYLCYCLOBUTYLAMINE HCL
Ref: 10-F305002
| 1g | 188.00 € | ||
| 5g | 685.00 € | ||
| 100mg | 29.00 € | ||
| 250mg | 61.00 € |
1-Phenylcyclobutanamine HCl
Ref: 3D-FP140863
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
