CAS 120221-68-3

3-(Trifluoromethyl)imidazo[1,5-a]pyridine-1-carboxylic acid

Description:

3-(Trifluoromethyl)imidazo[1,5-a]pyridine-1-carboxylic acid is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates a trifluoromethyl group and a carboxylic acid functional group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The imidazo[1,5-a]pyridine framework contributes to its potential as a pharmacophore, often associated with various biological activities, including antimicrobial and anticancer properties. The carboxylic acid group provides acidic characteristics, allowing for potential interactions in biological systems, such as hydrogen bonding and ionic interactions. This compound is typically synthesized through multi-step organic reactions and may be utilized in research related to drug development or as a building block in the synthesis of more complex molecules. Its unique structural features and functional groups make it a valuable compound in the field of organic and medicinal chemistry.

Formula: C₉H₅F₃N₂O₂

InChI: InChI=1S/C9H5F3N2O2/c10-9(11,12)8-13-6(7(15)16)5-3-1-2-4-14(5)8/h1-4H,(H,15,16)

InChI key: InChIKey=FSRQRDWXNRRZMD-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(=C(C(O)=O)N1)C=CC=C2

Synonyms:

• 3-(Trifluoromethyl)imidazo[1,5-a]pyridine-1-carboxylic acid
• Imidazo[1,5-a]pyridine-1-carboxylic acid, 3-(trifluoromethyl)-

3-(Trifluoromethyl)imidazo[1,5-a]pyridine-1-carboxylic acid

CAS: 120221-68-3

Versatile small molecule scaffold

Formula: C₉H₅F₃N₂O₂

Purity: Min. 95%

Molecular weight: 230.14 g/mol

Ref: 3D-VEA22168