CymitQuimica logo

CAS 1202245-70-2

:

B-[1-(Tetrahydro-2H-pyran-4-yl)ethenyl]boronic acid

Description:
B-[1-(Tetrahydro-2H-pyran-4-yl)ethenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various organic transformations, particularly in Suzuki coupling reactions. The compound features a tetrahydro-2H-pyran moiety, contributing to its cyclic structure and potentially influencing its solubility and reactivity. Boronic acids are typically polar and can form reversible complexes with diols, making them useful in the synthesis of complex organic molecules. This specific compound may exhibit properties such as moderate stability under ambient conditions, but it is sensitive to moisture and air due to the boronic acid group. Its applications may extend to medicinal chemistry, materials science, and organic synthesis, where it can serve as a building block or a reagent. Overall, the unique structural features of B-[1-(Tetrahydro-2H-pyran-4-yl)ethenyl]boronic acid make it a valuable compound in various chemical research and industrial applications.
Formula:C7H13BO3
InChI:InChI=1S/C7H13BO3/c1-6(8(9)10)7-2-4-11-5-3-7/h7,9-10H,1-5H2
InChI key:InChIKey=BWBVPSTXSTYGOK-UHFFFAOYSA-N
SMILES:C(B(O)O)(=C)C1CCOCC1
Synonyms:
  • [1-(Oxan-4-yl)ethenyl]boronic acid
  • Boronic acid, B-[1-(tetrahydro-2H-pyran-4-yl)ethenyl]-
  • B-[1-(Tetrahydro-2H-pyran-4-yl)ethenyl]boronic acid
  • 1-(Tetrahydro-2H-pyran-4-yl)vinylboronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.