CAS 120237-77-6

5-Methyl-4-thiazolecarbonyl chloride

Description:

5-Methyl-4-thiazolecarbonyl chloride is a chemical compound characterized by its thiazole ring structure, which incorporates a methyl group and a carbonyl chloride functional group. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals due to its reactive carbonyl chloride moiety, which can participate in acylation reactions. The thiazole ring contributes to its biological activity and can influence its solubility and reactivity. As a carbonyl chloride, it is likely to be sensitive to moisture and can release hydrochloric acid upon hydrolysis, necessitating careful handling and storage under anhydrous conditions. The compound may exhibit moderate to high toxicity, and appropriate safety measures should be taken when working with it, including the use of personal protective equipment. Its reactivity and structural features make it a valuable intermediate in synthetic chemistry, particularly in the development of compounds with potential therapeutic applications.

Formula: C₅H₄ClNOS

InChI: InChI=1S/C5H4ClNOS/c1-3-4(5(6)8)7-2-9-3/h2H,1H3

InChI key: InChIKey=ONNLJLPDPUWEOU-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C(C)SC=N1

Synonyms:

• 4-Thiazolecarbonyl chloride, 5-methyl-
• 5-Methyl-4-thiazolecarbonyl chloride