CymitQuimica logo

CAS 120239-62-5

:

3,3′,3′′,3′′′-(1,4-Butanediyldinitrilo)tetrakis[propanenitrile]

Description:
3,3′,3′′,3′′′-(1,4-Butanediyldinitrilo)tetrakis[propanenitrile], with the CAS number 120239-62-5, is a complex organic compound characterized by its tetrakis structure, which indicates the presence of four propanenitrile groups attached to a central butanediyldinitrile moiety. This compound features multiple nitrile (–C≡N) functional groups, which contribute to its polar nature and potential for hydrogen bonding. The presence of these nitrile groups often imparts significant solubility in polar solvents and can influence the compound's reactivity, particularly in coordination chemistry. The structural arrangement suggests potential applications in materials science, particularly in the synthesis of ligands for metal complexes or as intermediates in organic synthesis. Additionally, the compound's stability and reactivity can be affected by the steric and electronic properties of the substituents, making it a subject of interest in both theoretical and applied chemistry. Overall, its unique structure and functional groups position it as a versatile compound in various chemical applications.
Formula:C16H24N6
InChI:InChI=1S/C16H24N6/c17-7-3-13-21(14-4-8-18)11-1-2-12-22(15-5-9-19)16-6-10-20/h1-6,11-16H2
InChI key:InChIKey=SZHCRCQYMFGDFD-UHFFFAOYSA-N
SMILES:N(CCCCN(CCC#N)CCC#N)(CCC#N)CCC#N
Synonyms:
  • Propanenitrile, 3,3′,3′′,3′′′-(1,4-butanediyldinitrilo)tetrakis-
  • N,N,N′,N′-Tetrakis(2-cyanoethyl)-1,4-diaminobutane
  • 3,3′,3′′,3′′′-(1,4-Butanediyldinitrilo)tetrakis[propanenitrile]
  • 1,4-Bis[bis(2-cyanoethyl)amino]butane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.