CymitQuimica logo

CAS 1202450-63-2

:

Imidazo[1,2-a]pyridine, 6,8-dibromo-

Description:
Imidazo[1,2-a]pyridine, 6,8-dibromo- is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine substituents at the 6 and 8 positions enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits moderate to high lipophilicity due to its aromatic structure, which can affect its solubility in various solvents. Additionally, the dibromo substitution can lead to increased electron density in certain regions of the molecule, potentially impacting its interaction with biological targets. Imidazo[1,2-a]pyridine derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The compound's stability, reactivity, and potential applications in drug development make it a subject of interest in both synthetic and medicinal chemistry research. Safety data and handling precautions should be considered due to the presence of bromine, which can pose health risks.
Formula:C7H4Br2N2
InChI:InChI=1S/C7H4Br2N2/c8-5-3-6(9)7-10-1-2-11(7)4-5/h1-4H
InChI key:UPNQBHMDTPKBDP-UHFFFAOYSA-N
SMILES:C1=CN2C=C(C=C(C2=N1)Br)Br
Found 4 products.