CAS 1202478-44-1

Benzenemethanamine, α-cyclobutyl-4-fluoro-, hydrochloride (1:1), (αS)-

Description:

Benzenemethanamine, α-cyclobutyl-4-fluoro-, hydrochloride (1:1), (αS)-, is a chemical compound characterized by its amine functional group and a cyclobutyl substituent, which contributes to its unique structural properties. The presence of a fluorine atom at the para position of the benzene ring enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The (αS)- designation indicates a specific stereochemistry, which can be crucial for the compound's interaction with biological targets, potentially affecting its pharmacodynamics and pharmacokinetics. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions in chemical processes. Overall, its unique structure and properties make it of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₄FN·ClH

InChI: InChI=1S/C11H14FN.ClH/c12-10-6-4-9(5-7-10)11(13)8-2-1-3-8;/h4-8,11H,1-3,13H2;1H/t11-;/m0./s1

InChI key: InChIKey=KWXVMKOMLIVGAM-MERQFXBCSA-N

SMILES: [C@@H](N)(C1=CC=C(F)C=C1)C2CCC2.Cl

Synonyms:

• (S)-Cyclobutyl(4-fluorophenyl)methanamine hydrochloride
• Benzenemethanamine, α-cyclobutyl-4-fluoro-, hydrochloride (1:1), (αS)-