CAS 120256-23-7

3-Hydrazinyl-4-methoxypyridine

Description:

3-Hydrazinyl-4-methoxypyridine is an organic compound characterized by the presence of a pyridine ring substituted with both a hydrazinyl group and a methoxy group. The hydrazinyl group (-NH-NH2) is known for its reactivity, particularly in forming hydrazones and azo compounds, while the methoxy group (-OCH3) can influence the compound's solubility and electronic properties. This compound typically exhibits moderate polarity due to the presence of both hydrophilic and hydrophobic functional groups. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in synthetic organic chemistry. Additionally, the presence of the pyridine ring suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. The compound's stability, solubility, and reactivity can be influenced by factors such as pH and the presence of other functional groups in a reaction mixture. Overall, 3-Hydrazinyl-4-methoxypyridine is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₆H₉N₃O

InChI: InChI=1S/C6H9N3O/c1-10-6-2-3-8-4-5(6)9-7/h2-4,9H,7H2,1H3

InChI key: InChIKey=VSTJBEBZZRAUDL-UHFFFAOYSA-N

SMILES: N(N)C=1C(OC)=CC=NC1

Synonyms:

• Pyridine, 3-hydrazino-4-methoxy-
• 3-Hydrazinyl-4-methoxypyridine
• (4-Methoxypyridin-3-yl)hydrazine
• Pyridine, 3-hydrazinyl-4-methoxy-