CAS 1202644-28-7

1-Chloro-3,5-dicyclopropylbenzene

Description:

1-Chloro-3,5-dicyclopropylbenzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a chlorine atom and two dicyclopropyl groups at the 3 and 5 positions. This compound is part of the chlorobenzene family and exhibits properties typical of chlorinated aromatic hydrocarbons, such as moderate volatility and potential hydrophobicity. The presence of the dicyclopropyl groups contributes to its steric bulk, which can influence its reactivity and interactions with other molecules. It may exhibit unique chemical behavior due to the combination of the electron-withdrawing chlorine atom and the electron-donating dicyclopropyl groups, potentially affecting its stability and reactivity in various chemical reactions. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and the presence of the chlorine substituent. As with many chlorinated compounds, it is essential to consider its environmental impact and potential toxicity in applications and handling.

Formula: C₁₂H₁₃Cl

InChI: InChI=1S/C12H13Cl/c13-12-6-10(8-1-2-8)5-11(7-12)9-3-4-9/h5-9H,1-4H2

InChI key: InChIKey=HCUGGJSBCAIJNT-UHFFFAOYSA-N

SMILES: ClC1=CC(=CC(=C1)C2CC2)C3CC3

Synonyms:

• 1-Chloro-3,5-dicyclopropylbenzene
• Benzene, 1-chloro-3,5-dicyclopropyl-