CAS 120276-47-3
:Pyridine, 3-(bromomethyl)-5-methyl- (9CI)
Description:
Pyridine, 3-(bromomethyl)-5-methyl- (9CI), with the CAS number 120276-47-3, is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromomethyl group at the 3-position and a methyl group at the 5-position. This compound exhibits typical pyridine properties, including a basic nitrogen atom that can participate in protonation and coordination with metal ions. The presence of the bromomethyl group introduces reactivity, making it a potential intermediate in various organic synthesis reactions, such as nucleophilic substitution or coupling reactions. The methyl group contributes to the compound's hydrophobic character and can influence its solubility in organic solvents. Pyridine derivatives are often used in pharmaceuticals, agrochemicals, and as building blocks in organic synthesis. The compound's physical properties, such as boiling point, melting point, and solubility, can vary based on the specific substituents and their positions on the pyridine ring. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.
Formula:C7H8BrN
InChI:InChI=1/C7H8BrN/c1-6-2-7(3-8)5-9-4-6/h2,4-5H,3H2,1H3
SMILES:Cc1cc(CBr)cnc1
Synonyms:- 3-(Bromomethyl)-5-methylpyridine
- Pyridine, 3-(Bromomethyl)-5-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
