
CAS 120276-48-4
:3-Bromo-5-(iodomethyl)pyridine
Description:
3-Bromo-5-(iodomethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and iodomethyl groups. The bromine atom is located at the 3-position, while the iodomethyl group is situated at the 5-position of the pyridine ring. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of both halogen substituents can impart unique reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which can be explored for potential pharmaceutical applications. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C6H5BrIN
InChI:InChI=1S/C6H5BrIN/c7-6-1-5(2-8)3-9-4-6/h1,3-4H,2H2
InChI key:InChIKey=OAETZNCCQPFSBL-UHFFFAOYSA-N
SMILES:C(I)C=1C=C(Br)C=NC1
Synonyms:- 3-Bromo-5-iodomethylpyridine
- 3-Bromo-5-(iodomethyl)pyridine
- Pyridine, 3-bromo-5-(iodomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.