
CAS 1202769-74-1
:2-(3-Methyl-1,2,4-oxadiazol-5-yl)-3-butyn-2-ol
Description:
2-(3-Methyl-1,2,4-oxadiazol-5-yl)-3-butyn-2-ol is a chemical compound characterized by its unique structure, which includes a butynol moiety and a 3-methyl-1,2,4-oxadiazole ring. The presence of the oxadiazole ring imparts specific electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The compound features a hydroxyl group (-OH) that contributes to its reactivity and solubility in polar solvents. Its butynyl group indicates the presence of a triple bond, which can participate in further chemical reactions, such as nucleophilic additions or cycloadditions. The molecular structure suggests that it may exhibit interesting biological activities, although specific biological data would require further investigation. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the oxadiazole ring and the alkyne functional group. Overall, 2-(3-Methyl-1,2,4-oxadiazol-5-yl)-3-butyn-2-ol represents a versatile structure with potential applications in synthetic chemistry and material science.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c1-4-7(3,10)6-8-5(2)9-11-6/h1,10H,2-3H3
InChI key:InChIKey=ZCRRDOIAQHMMAT-UHFFFAOYSA-N
SMILES:C(C#C)(C)(O)C1=NC(C)=NO1
Synonyms:- α-Ethynyl-α,3-dimethyl-1,2,4-oxadiazole-5-methanol
- 2-(3-Methyl-1,2,4-oxadiazol-5-yl)-3-butyn-2-ol
- 1,2,4-Oxadiazole-5-methanol, α-ethynyl-α,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.