
CAS 120277-13-6
:3-(Bromomethyl)-5-chloropyridine
Description:
3-(Bromomethyl)-5-chloropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with both a bromomethyl group and a chlorine atom. The presence of these halogen substituents significantly influences its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate to high polarity due to the electronegative halogens, which can also enhance their solubility in polar solvents. The bromomethyl group can serve as a reactive site for further chemical modifications, making it a valuable intermediate in organic synthesis. Additionally, the chloropyridine structure may impart biological activity, as many halogenated pyridines are known for their pharmacological properties. The compound is likely to be stable under standard conditions but may undergo reactions such as nucleophilic substitution or electrophilic aromatic substitution, depending on the reaction environment. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental hazards.
Formula:C6H5BrClN
InChI:InChI=1S/C6H5BrClN/c7-2-5-1-6(8)4-9-3-5/h1,3-4H,2H2
InChI key:InChIKey=PSRPKNNXHNFILZ-UHFFFAOYSA-N
SMILES:C(Br)C=1C=C(Cl)C=NC1
Synonyms:- 3-Bromomethyl-5-chloropyridine
- Pyridine, 3-(bromomethyl)-5-chloro-
- 3-(Bromomethyl)-5-chloropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.