CAS 120277-14-7
:3-(Bromomethyl)-5-fluoropyridine
Description:
3-(Bromomethyl)-5-fluoropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromomethyl group at the 3-position and a fluorine atom at the 5-position contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits moderate polarity due to the electronegative bromine and fluorine substituents, which can influence its solubility in organic solvents. The compound is of interest in medicinal chemistry and material science, as the halogen substituents can enhance biological activity and facilitate further chemical modifications. Safety precautions should be taken when handling this substance, as it may be harmful if inhaled or ingested, and appropriate protective equipment should be used to avoid skin and eye contact.
Formula:C6H5BrFN
InChI:InChI=1S/C6H5BrFN/c7-2-5-1-6(8)4-9-3-5/h1,3-4H,2H2
InChI key:InChIKey=PLZOKCHSJPBRND-UHFFFAOYSA-N
SMILES:C(Br)C=1C=C(F)C=NC1
Synonyms:- 3-(Bromomethyl)-5-fluoropyridine
- Pyridine, 3-(Bromomethyl)-5-Fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

