CymitQuimica logo

CAS 120277-70-5

:

3-(Bromomethyl)quinoline

Description:
3-(Bromomethyl)quinoline is an organic compound characterized by the presence of a bromomethyl group attached to the quinoline ring system. Quinoline itself is a bicyclic aromatic compound composed of a benzene ring fused to a pyridine ring, which imparts significant aromatic stability and reactivity. The bromomethyl substituent introduces a reactive site, making the compound useful in various chemical reactions, such as nucleophilic substitutions and coupling reactions. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including moderate solubility in organic solvents and potential biological activity. Its structure allows for interactions with biological targets, which may be of interest in medicinal chemistry. Additionally, the presence of the bromine atom can influence the compound's reactivity and stability, making it a valuable intermediate in synthetic organic chemistry. Safety considerations should be taken into account due to the potential toxicity of brominated compounds. Overall, 3-(Bromomethyl)quinoline serves as a versatile building block in the synthesis of more complex molecules.
Formula:C10H8BrN
InChI:InChI=1S/C10H8BrN/c11-6-8-5-9-3-1-2-4-10(9)12-7-8/h1-5,7H,6H2
InChI key:InChIKey=XWWZTYWUMVMFNF-UHFFFAOYSA-N
SMILES:C(Br)C1=CC2=C(N=C1)C=CC=C2
Synonyms:
  • Quinoline, 3-(bromomethyl)-
  • 3-(Bromomethyl)quinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.