CAS 1202780-80-0
:4-Amino-5-nitronicotinonitrile
Description:
4-Amino-5-nitronicotinonitrile is a chemical compound characterized by its unique structure, which includes an amino group and a nitro group attached to a pyridine ring. This compound is part of the broader class of nitro-substituted heterocycles, which are known for their diverse biological activities and potential applications in pharmaceuticals. The presence of both amino and nitro groups can influence its reactivity and solubility, making it a subject of interest in medicinal chemistry. Typically, compounds like 4-Amino-5-nitronicotinonitrile may exhibit properties such as moderate to high polarity due to the functional groups, which can affect their interaction with biological systems. Additionally, the nitrile groups contribute to the compound's potential as a building block in organic synthesis. Safety and handling precautions are essential when working with such compounds, as they may pose health risks or environmental hazards. Overall, 4-Amino-5-nitronicotinonitrile represents a fascinating area of study within organic and medicinal chemistry.
Formula:C6H4N4O2
InChI:InChI=1S/C6H4N4O2/c7-1-4-2-9-3-5(6(4)8)10(11)12/h2-3H,(H2,8,9)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
