
CAS 1202781-09-6
:1,1-Dimethylethyl 3-[(2-bromoacetyl)amino]-1-azetidinecarboxylate
Description:
1,1-Dimethylethyl 3-[(2-bromoacetyl)amino]-1-azetidinecarboxylate is a chemical compound characterized by its unique structural features, which include an azetidine ring and a bromoacetyl group. The presence of the dimethyl group contributes to its steric bulk, influencing its reactivity and interaction with biological systems. This compound may exhibit properties typical of azetidine derivatives, such as potential biological activity, which could include antimicrobial or anticancer effects, although specific biological data would depend on empirical studies. The bromoacetyl moiety can serve as a reactive site for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the ester functional group suggests potential for hydrolysis under certain conditions, which could affect its stability and solubility in various solvents. Overall, the characteristics of this compound make it of interest in medicinal chemistry and synthetic applications, though detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C10H17BrN2O3
InChI:InChI=1S/C10H17BrN2O3/c1-10(2,3)16-9(15)13-5-7(6-13)12-8(14)4-11/h7H,4-6H2,1-3H3,(H,12,14)
InChI key:InChIKey=GODJBUNTFGQXTD-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(NC(CBr)=O)C1
Synonyms:- 1-Azetidinecarboxylic acid, 3-[(2-bromoacetyl)amino]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-[(2-bromoacetyl)amino]-1-azetidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.