CAS 120279-87-0

5,6-Dihydro-6-methyl-4-oxo-4H-thieno[2,3-b]thiopyran-2-sulfonyl chloride

Description:

5,6-Dihydro-6-methyl-4-oxo-4H-thieno[2,3-b]thiopyran-2-sulfonyl chloride is a chemical compound characterized by its unique thieno[2,3-b]thiopyran structure, which incorporates a sulfonyl chloride functional group. This compound typically exhibits a yellow to brown color and is soluble in organic solvents, making it useful in various chemical reactions. The presence of the sulfonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound's structure includes a fused ring system, contributing to its stability and reactivity. Additionally, the presence of the methyl and carbonyl groups influences its chemical behavior, potentially affecting its biological activity. As with many sulfonyl chlorides, it is important to handle this compound with care due to its reactivity and potential hazards, including irritation to skin and respiratory pathways. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₈H₇ClO₃S₃

InChI: InChI=1S/C8H7ClO3S3/c1-4-2-6(10)5-3-7(15(9,11)12)14-8(5)13-4/h3-4H,2H2,1H3

InChI key: InChIKey=ULWSBNDSDFOIHY-UHFFFAOYSA-N

SMILES: O=C1C2=C(SC(S(Cl)(=O)=O)=C2)SC(C)C1

Synonyms:

• 5,6-Dihydro-6-methyl-4-oxo-4H-thieno[2,3-b]thiopyran-2-sulfonyl chloride
• 4H-Thieno[2,3-b]thiopyran-2-sulfonyl chloride, 5,6-dihydro-6-methyl-4-oxo-