CAS 120280-13-9
:trans-6-Methyl-4-ethylamino-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide-7,7-dioxide
Description:
Trans-6-Methyl-4-ethylamino-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide-7,7-dioxide, with CAS number 120280-13-9, is a chemical compound characterized by its complex thieno-thiopyran structure, which incorporates both sulfur and nitrogen functionalities. This compound features a sulfonamide group, contributing to its potential biological activity, particularly in medicinal chemistry. The presence of the methyl and ethylamino substituents suggests that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. The dihydro form indicates that it has a saturated ring system, which can affect its stability and reactivity. Additionally, the trans configuration implies a specific spatial arrangement of substituents that may be crucial for its biological activity. Overall, this compound is of interest in the field of drug discovery and development, particularly for its potential therapeutic applications, although detailed studies would be necessary to elucidate its specific properties and mechanisms of action.
Formula:C10H16N2O4S3
InChI:InChI=1S/C10H16N2O4S3/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16/h5-6,8,12H,3-4H2,1-2H3,(H2,11,15,16)
InChI key:InChIKey=IAVUPMFITXYVAF-UHFFFAOYSA-N
SMILES:O=S1(=O)C2=C(C(NCC)CC1C)C=C(S(N)(=O)=O)S2
Synonyms:- 4-(Ethylamino)-5,6-Dihydro-6-Methyl-4H-Thieno[2,3-B]Thiopyran-2-Sulfonamide 7,7-Dioxide
- 4H-Thieno[2,3-b]thiopyran-2-sulfonamide, 4-(ethylamino)-5,6-dihydro-6-methyl-, 7,7-dioxide
- trans-6-methyl-4-ethylamino-5,6-dihydro-4h-thieno[2,3-b]thiopyran-2-sulfonamide-7,7-dioxide
- 4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.