CAS 120281-56-3
:2-Iodo-5-phenylpyridine
Description:
2-Iodo-5-phenylpyridine is an organic compound characterized by its pyridine ring substituted with both an iodine atom and a phenyl group. The presence of the iodine atom introduces notable reactivity, particularly in nucleophilic substitution reactions, while the phenyl group contributes to the compound's aromatic character and can influence its electronic properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as dichloromethane and ethanol. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for studies in materials science. Safety considerations should be taken into account, as iodine-containing compounds can be hazardous, and appropriate handling and storage protocols should be followed. Overall, 2-Iodo-5-phenylpyridine is a versatile compound with significant implications in various fields of chemical research.
Formula:C11H8IN
InChI:InChI=1/C11H8IN/c12-11-7-6-10(8-13-11)9-4-2-1-3-5-9/h1-8H
SMILES:c1ccc(cc1)c1ccc(I)nc1
Synonyms:- Pyridine, 2-Iodo-5-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.