CAS 1202858-84-1

2-(2,5-Dimethyl-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-(2,5-Dimethyl-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a nitrophenyl substituent. The presence of the dioxaborolane moiety suggests potential applications in organic synthesis and materials science, particularly in the development of boron-based reagents or catalysts. The nitrophenyl group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, the presence of multiple methyl groups contributes to steric hindrance, potentially affecting the compound's solubility and interaction with other molecules. This compound may exhibit interesting photophysical properties due to its aromatic structure, making it a candidate for studies in fluorescence or as a dye. Its specific applications would depend on further investigation into its reactivity and interaction with various substrates in chemical reactions. Overall, this compound represents a complex interplay of functional groups that can be leveraged in various chemical contexts.

Formula: C₁₄H₂₀BNO₄

InChI: InChI=1S/C14H20BNO4/c1-9-8-12(16(17)18)10(2)7-11(9)15-19-13(3,4)14(5,6)20-15/h7-8H,1-6H3

InChI key: InChIKey=NFBHNSHOEFXXCY-UHFFFAOYSA-N

SMILES: CC1=C(B2OC(C)(C)C(C)(C)O2)C=C(C)C(N(=O)=O)=C1

Synonyms:

• 1,3,2-Dioxaborolane, 2-(2,5-dimethyl-4-nitrophenyl)-4,4,5,5-tetramethyl-
• 2-(2,5-Dimethyl-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane