CAS 1202864-50-3: 4-[2-Hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]benzeneacetamide
Description:4-[2-Hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]benzeneacetamide, with the CAS number 1202864-50-3, is a synthetic organic compound characterized by its complex structure, which includes a benzene ring substituted with a hydroxy group and an acetamide moiety. The presence of deuterated methyl and ethyl groups indicates that this compound is isotopically labeled, which can be useful in various applications such as pharmacokinetic studies or metabolic tracing. The hydroxy and amino functional groups suggest potential for hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its molecular interactions could be studied to understand its pharmacological properties, including efficacy and safety profiles. Overall, the unique isotopic labeling and functional groups contribute to its potential applications in research and development within the pharmaceutical industry.
Formula:C14H15D7N2O3
InChI:InChI=1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18)/i1D3,2D3,10D
InChI key:InChIKey=METKIMKYRPQLGS-SVMCCORHSA-N
SMILES:O=C(N)CC1=CC=C(OCC(O)CNC(C)C)C=C1
- Synonyms:
- Benzeneacetamide, 4-[2-hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]-
- 4-[2-Hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]benzeneacetamide
- Atenolol-d7
![4-[2-Hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]benzeneacetamide](https://static.cymitquimica.com/cas-image/303522-4-2-hydroxy-3-1-methyl-d3-ethyl-1222-d4-amino-propoxy-benzeneacetamide.png)
