CAS 1202867-00-2

2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(3,4-dihydroxyphenyl)methylene]hydrazide, hydrate (1:?)

Description:

2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(3,4-dihydroxyphenyl)methylene]hydrazide, hydrate (CAS 1202867-00-2) is a chemical compound characterized by its complex structure, which includes a naphthalene ring system, a carboxylic acid functional group, and a hydrazide moiety. This compound typically exhibits properties associated with both hydrophilic and hydrophobic regions due to its multiple functional groups, which can influence its solubility and reactivity. The presence of hydroxyl groups suggests potential for hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the hydrazide functional group may exhibit biological activity, making it of interest in pharmaceutical and medicinal chemistry. The hydrate form indicates that it can associate with water molecules, which may affect its stability and behavior in various environments. Overall, this compound's unique structural features contribute to its potential applications in various fields, including organic synthesis and drug development.

Formula: C₁₈H₁₄N₂O₄·xH₂O

InChI: InChI=1S/C18H14N2O4.H2O/c21-15-6-5-11(7-17(15)23)10-19-20-18(24)14-8-12-3-1-2-4-13(12)9-16(14)22;/h1-10,21-23H,(H,20,24);1H2

InChI key: InChIKey=FKWZHQSDBMSHTN-UHFFFAOYSA-N

SMILES: C(NN=CC1=CC(O)=C(O)C=C1)(=O)C2=CC3=C(C=C2O)C=CC=C3.O

Synonyms:

• 2-Naphthalenecarboxylic acid, 3-hydroxy-, 2-[(3,4-dihydroxyphenyl)methylene]hydrazide, hydrate (1:?)