CAS 1203-25-4
:6-Chloro-1,3-dimethyl-5-nitro-2,4(1H,3H)-pyrimidinedione
Description:
6-Chloro-1,3-dimethyl-5-nitro-2,4(1H,3H)-pyrimidinedione, with the CAS number 1203-25-4, is a heterocyclic organic compound characterized by a pyrimidinedione core structure. This compound features a chlorine atom at the 6-position, two methyl groups at the 1 and 3 positions, and a nitro group at the 5-position, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in polar organic solvents. The presence of the nitro group imparts significant reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structural features suggest potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of biologically active compounds. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C6H6ClN3O4
InChI:InChI=1S/C6H6ClN3O4/c1-8-4(7)3(10(13)14)5(11)9(2)6(8)12/h1-2H3
InChI key:InChIKey=ZOPMTVMJANWXKJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Cl)N(C)C(=O)N(C)C1=O
Synonyms:- Uracil, 6-chloro-1,3-dimethyl-5-nitro-
- 2,4(1H,3H)-Pyrimidinedione, 6-chloro-1,3-dimethyl-5-nitro-
- 6-Chloro-1,3-dimethyl-5-nitrouracil
- 1,3-Dimethyl-5-nitro-6-chlorouracil
- 6-Chloro-1,3-dimethyl-5-nitro-2,4(1H,3H)-pyrimidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-1,3-dimethyl-5-nitrouracil
CAS:Controlled ProductFormula:C6H6ClN3O4Color and Shape:NeatMolecular weight:219.583
