CAS 1203-44-7

Cyclopropanamine, 2-(1-naphthalenyl)-, hydrochloride (1:1)

Description:

Cyclopropanamine, 2-(1-naphthalenyl)-, hydrochloride (1:1), with the CAS number 1203-44-7, is a chemical compound characterized by its cyclopropane structure fused with an amine group and a naphthalene moiety. This compound typically appears as a white to off-white crystalline solid, indicating its hydrochloride salt form, which enhances its solubility in water. The presence of the naphthalene ring contributes to its aromatic properties, potentially influencing its reactivity and interaction with biological systems. Cyclopropanamines are known for their unique strain in the cyclopropane ring, which can lead to interesting chemical behavior, including reactivity in nucleophilic substitution reactions. The hydrochloride form suggests that it can be used in various applications, including pharmaceuticals, where it may serve as an intermediate or active ingredient. Its specific characteristics, such as melting point, boiling point, and spectral data, would be essential for practical applications and further research. As with many amines, it may exhibit basic properties, making it relevant in organic synthesis and medicinal chemistry.

Formula: C₁₃H₁₃N·ClH

InChI: InChI=1S/C13H13N.ClH/c14-13-8-12(13)11-7-3-5-9-4-1-2-6-10(9)11;/h1-7,12-13H,8,14H2;1H

InChI key: InChIKey=KMWMHGPIBUFOLA-UHFFFAOYSA-N

SMILES: NC1C(C=2C3=C(C=CC2)C=CC=C3)C1.Cl

Synonyms:

• Cyclopropylamine, 2-(1-naphthyl)-, hydrochloride
• Cyclopropanamine, 2-(1-naphthalenyl)-, hydrochloride (1:1)
• 2-(Naphthalen-1-yl)cyclopropan-1-amine hydrochloride