CAS 1203-55-0

NAPHTHO[2,1-D]THIAZOL-2-YLAMINE

Description:

Naphtho[2,1-d]thiazol-2-ylamine, with the CAS number 1203-55-0, is an organic compound characterized by its fused naphthalene and thiazole rings, which contribute to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the amino group (-NH2) on the thiazole ring enhances its reactivity, making it a useful intermediate in organic synthesis. Naphtho[2,1-d]thiazol-2-ylamine may exhibit biological activity, which has led to research into its role as a potential therapeutic agent. Its molecular structure allows for interactions with biological targets, and it may participate in various chemical reactions, including electrophilic substitutions and coupling reactions. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, naphtho[2,1-d]thiazol-2-ylamine is a compound of interest due to its structural features and potential utility in chemical research and applications.

Formula: C₁₁H₈N₂S

InChI: InChI=1/C11H8N2S/c12-11-13-9-6-5-7-3-1-2-4-8(7)10(9)14-11/h1-6H,(H2,12,13)

SMILES: c1ccc2c(c1)ccc1c2sc(=N)[nH]1

Synonyms:

• Iflab-Bb F1386-0396
• Naphtho[2,1-D][1,3]Thiazol-2-Amine
• Naphtho[2,1-d]thiazol-2-amine (9CI)

Naphtho[2,1- d ]thiazol-2-ylamine

CAS: 1203-55-0

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 200.25999450683594

Ref: 10-F030009