CAS 1203-71-0

4-Chloro-2,3,6-trimethylquinoline

Description:

4-Chloro-2,3,6-trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features a chlorine atom at the 4-position and three methyl groups at the 2, 3, and 6 positions of the quinoline ring, contributing to its unique chemical properties. It is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of the chlorine atom and multiple methyl groups influences its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, 4-Chloro-2,3,6-trimethylquinoline may exhibit biological activity, which has drawn interest in medicinal chemistry and material science. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is of interest for its synthetic utility and potential applications in various fields.

Formula: C₁₂H₁₂ClN

InChI: InChI=1S/C12H12ClN/c1-7-4-5-11-10(6-7)12(13)8(2)9(3)14-11/h4-6H,1-3H3

InChI key: InChIKey=IUQCFVPXSUQQSC-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(C)C1C)C=CC(C)=C2

Synonyms:

• 4-Chloro-2,3,6-trimethylquinoline
• Quinoline, 4-chloro-2,3,6-trimethyl-

4-Chloro-2,3,6-trimethylquinoline

Controlled Product

CAS: 1203-71-0

Formula: C₁₂H₁₂ClN

Color and Shape: Neat

Molecular weight: 205.683

Ref: TR-C205450